C42H54N6O5 — CID 71084735
benzyl N-[4-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-5-[3-(4-methylpiperazin-1-yl)propylamino]-5-oxopentyl]carbamate (PubChem CID 71084735) has the molecular formula C42H54N6O5 and a molecular weight of 722.93 g/mol. Its IUPAC name is benzyl N-[4-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-5-[3-(4-methylpiperazin-1-yl)propylamino]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[4-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-5-[3-(4-methylpiperazin-1-yl)propylamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 71084735 |
| Molecular Formula | C42H54N6O5 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.42 |
| IUPAC Name | benzyl N-[4-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-5-[3-(4-methylpiperazin-1-yl)propylamino]-5-oxopentyl]carbamate |
| SMILES | CCCCc1ccc2nc(-c3ccc(OC)cc3)cc(C(=O)NC(CCCNC(=O)OCc3ccccc3)C(=O)NCCCN3CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C42H54N6O5/c1-4-5-11-31-15-20-37-35(28-31)36(29-39(45-37)33-16-18-34(52-3)19-17-33)40(49)46-38(41(50)43-22-10-23-48-26-24-47(2)25-27-48)14-9-21-44-42(51)53-30-32-12-7-6-8-13-32/h6-8,12-13,15-20,28-29,38H,4-5,9-11,14,21-27,30H2,1-3H3,(H,43,50)(H,44,51)(H,46,49) |
| InChIKey | NWIZRBOLNUOVLM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|