About 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene
4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene (PubChem CID 58266963) has the molecular formula C11H14S
and a molecular weight of 178.30 g/mol. Its IUPAC name is 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene.
Analyze 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene?
The IUPAC name of 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene (CID 58266963) is 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene.
What is the SMILES notation for 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene?
The canonical SMILES for 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene is Cc1cc2c(s1)C1CCCC2C1.
What is the InChIKey of 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene?
The InChIKey is KSLOKRVGIDNROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S/c1-7-5-10-8-3-2-4-9(6-8)11(10)12-7/h5,8-9H,2-4,6H2,1H3.
What are the key properties of 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene?
4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene has a molecular weight of 178.30 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-thiatricyclo[5.3.1.02,6]undeca-2(6),4-diene is sourced from PubChem (CID 58266963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).