C34H46N6O3S — CID 58281118
(2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-(1H-indol-2-ylmethyl)-4-oxohexanamide (PubChem CID 58281118) has the molecular formula C34H46N6O3S and a molecular weight of 618.85 g/mol. Its IUPAC name is (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-(1H-indol-2-ylmethyl)-4-oxohexanamide.
| Compound Name | (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-(1H-indol-2-ylmethyl)-4-oxohexanamide |
|---|---|
| PubChem CID | 58281118 |
| Molecular Formula | C34H46N6O3S |
| Molecular Weight | 618.85 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | (2R,5R)-5-amino-N-[(3R)-7-azido-3-benzyl-2-methyl-4-oxoheptan-2-yl]-6-tert-butylsulfanyl-2-(1H-indol-2-ylmethyl)-4-oxohexanamide |
| SMILES | CC(C)(C)SC[C@H](N)C(=O)C[C@@H](Cc1cc2ccccc2[nH]1)C(=O)NC(C)(C)[C@@H](Cc1ccccc1)C(=O)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C34H46N6O3S/c1-33(2,3)44-22-28(35)31(42)21-25(20-26-19-24-14-9-10-15-29(24)38-26)32(43)39-34(4,5)27(18-23-12-7-6-8-13-23)30(41)16-11-17-37-40-36/h6-10,12-15,19,25,27-28,38H,11,16-18,20-22,35H2,1-5H3,(H,39,43)/t25-,27+,28+/m1/s1 |
| InChIKey | JLLZCKZZYGNOHM-PKXQUSJVSA-N |
| XLogP | 6.56 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.85 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|