C17H30O2 — CID 58282920
(6E,10Z)-2-hydroxy-2-methylhexadeca-6,10-dien-5-one (PubChem CID 58282920) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (6E,10Z)-2-hydroxy-2-methylhexadeca-6,10-dien-5-one.
| Compound Name | (6E,10Z)-2-hydroxy-2-methylhexadeca-6,10-dien-5-one |
|---|---|
| PubChem CID | 58282920 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (6E,10Z)-2-hydroxy-2-methylhexadeca-6,10-dien-5-one |
| SMILES | CCCCC/C=C\CC/C=C/C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C17H30O2/c1-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17(2,3)19/h8-9,12-13,19H,4-7,10-11,14-15H2,1-3H3/b9-8-,13-12+ |
| InChIKey | ORULAPNTNQOSFL-YILALFFRSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|