C17H32O2 — CID 58282921
(E)-2-hydroxy-2-methylhexadec-6-en-5-one (PubChem CID 58282921) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (E)-2-hydroxy-2-methylhexadec-6-en-5-one.
| Compound Name | (E)-2-hydroxy-2-methylhexadec-6-en-5-one |
|---|---|
| PubChem CID | 58282921 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (E)-2-hydroxy-2-methylhexadec-6-en-5-one |
| SMILES | CCCCCCCCC/C=C/C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C17H32O2/c1-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17(2,3)19/h12-13,19H,4-11,14-15H2,1-3H3/b13-12+ |
| InChIKey | TYFPHXWFKZAWKK-OUKQBFOZSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|