C25H23Cl2NO2S — CID 58285066
3-[3-(2,4-dichlorophenoxy)-2,3-dihydro-1H-inden-5-yl]-N-(2-methylsulfanylethyl)benzamide (PubChem CID 58285066) has the molecular formula C25H23Cl2NO2S and a molecular weight of 472.44 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenoxy)-2,3-dihydro-1H-inden-5-yl]-N-(2-methylsulfanylethyl)benzamide.
| Compound Name | 3-[3-(2,4-dichlorophenoxy)-2,3-dihydro-1H-inden-5-yl]-N-(2-methylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 58285066 |
| Molecular Formula | C25H23Cl2NO2S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 3-[3-(2,4-dichlorophenoxy)-2,3-dihydro-1H-inden-5-yl]-N-(2-methylsulfanylethyl)benzamide |
| SMILES | CSCCNC(=O)c1cccc(-c2ccc3c(c2)C(Oc2ccc(Cl)cc2Cl)CC3)c1 |
| InChI | InChI=1S/C25H23Cl2NO2S/c1-31-12-11-28-25(29)19-4-2-3-17(13-19)18-6-5-16-7-9-23(21(16)14-18)30-24-10-8-20(26)15-22(24)27/h2-6,8,10,13-15,23H,7,9,11-12H2,1H3,(H,28,29) |
| InChIKey | DRQMIKDYIUPTKF-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|