C24H19Cl2N3O — CID 58284983
N-(2-cyanoethyl)-3-[1-(2,5-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide (PubChem CID 58284983) has the molecular formula C24H19Cl2N3O and a molecular weight of 436.34 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[1-(2,5-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-3-[1-(2,5-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide |
|---|---|
| PubChem CID | 58284983 |
| Molecular Formula | C24H19Cl2N3O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(2-cyanoethyl)-3-[1-(2,5-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide |
| SMILES | N#CCCNC(=O)c1cccc(-c2ccc3c(c2)N(c2cc(Cl)ccc2Cl)CC3)c1 |
| InChI | InChI=1S/C24H19Cl2N3O/c25-20-7-8-21(26)23(15-20)29-12-9-16-5-6-18(14-22(16)29)17-3-1-4-19(13-17)24(30)28-11-2-10-27/h1,3-8,13-15H,2,9,11-12H2,(H,28,30) |
| InChIKey | IASVQBBQZJJBET-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|