C23H19Cl2N3O2 — CID 58285014
N-(2-amino-2-oxoethyl)-3-[1-(2,3-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide (PubChem CID 58285014) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-[1-(2,3-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-[1-(2,3-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide |
|---|---|
| PubChem CID | 58285014 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-[1-(2,3-dichlorophenyl)-2,3-dihydroindol-6-yl]benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc(-c2ccc3c(c2)N(c2cccc(Cl)c2Cl)CC3)c1 |
| InChI | InChI=1S/C23H19Cl2N3O2/c24-18-5-2-6-19(22(18)25)28-10-9-14-7-8-16(12-20(14)28)15-3-1-4-17(11-15)23(30)27-13-21(26)29/h1-8,11-12H,9-10,13H2,(H2,26,29)(H,27,30) |
| InChIKey | MKRWDYHPRSXTTG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |