C25H20Cl2N2O — CID 58285015
5-[3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]phenyl]-5-oxopentanenitrile (PubChem CID 58285015) has the molecular formula C25H20Cl2N2O and a molecular weight of 435.35 g/mol. Its IUPAC name is 5-[3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]phenyl]-5-oxopentanenitrile.
| Compound Name | 5-[3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]phenyl]-5-oxopentanenitrile |
|---|---|
| PubChem CID | 58285015 |
| Molecular Formula | C25H20Cl2N2O |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 5-[3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]phenyl]-5-oxopentanenitrile |
| SMILES | N#CCCCC(=O)c1cccc(-c2ccc3c(c2)N(c2ccc(Cl)cc2Cl)CC3)c1 |
| InChI | InChI=1S/C25H20Cl2N2O/c26-21-9-10-23(22(27)16-21)29-13-11-17-7-8-19(15-24(17)29)18-4-3-5-20(14-18)25(30)6-1-2-12-28/h3-5,7-10,14-16H,1-2,6,11,13H2 |
| InChIKey | QGWAJVXZWVYQSW-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|