C21H15Cl2NO2 — CID 67059831
3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]benzoic acid (PubChem CID 67059831) has the molecular formula C21H15Cl2NO2 and a molecular weight of 384.26 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]benzoic acid.
| Compound Name | 3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]benzoic acid |
|---|---|
| PubChem CID | 67059831 |
| Molecular Formula | C21H15Cl2NO2 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)-2,3-dihydroindol-6-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc3c(c2)N(c2ccc(Cl)cc2Cl)CC3)c1 |
| InChI | InChI=1S/C21H15Cl2NO2/c22-17-6-7-19(18(23)12-17)24-9-8-13-4-5-15(11-20(13)24)14-2-1-3-16(10-14)21(25)26/h1-7,10-12H,8-9H2,(H,25,26) |
| InChIKey | OCOPJXQMPTWITM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |