C25H21Cl2N3O — CID 58284971
N-(2-cyanoethyl)-3-[1-[(3,4-dichlorophenyl)methyl]-2,3-dihydroindol-6-yl]benzamide (PubChem CID 58284971) has the molecular formula C25H21Cl2N3O and a molecular weight of 450.37 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[1-[(3,4-dichlorophenyl)methyl]-2,3-dihydroindol-6-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-3-[1-[(3,4-dichlorophenyl)methyl]-2,3-dihydroindol-6-yl]benzamide |
|---|---|
| PubChem CID | 58284971 |
| Molecular Formula | C25H21Cl2N3O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(2-cyanoethyl)-3-[1-[(3,4-dichlorophenyl)methyl]-2,3-dihydroindol-6-yl]benzamide |
| SMILES | N#CCCNC(=O)c1cccc(-c2ccc3c(c2)N(Cc2ccc(Cl)c(Cl)c2)CC3)c1 |
| InChI | InChI=1S/C25H21Cl2N3O/c26-22-8-5-17(13-23(22)27)16-30-12-9-18-6-7-20(15-24(18)30)19-3-1-4-21(14-19)25(31)29-11-2-10-28/h1,3-8,13-15H,2,9,11-12,16H2,(H,29,31) |
| InChIKey | MBRCUNBHJNJSQI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|