C23H18Cl2N2O2 — CID 58285058
3-[1-(2,4-dichlorophenyl)indol-6-yl]-N-(2-hydroxyethyl)benzamide (PubChem CID 58285058) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)indol-6-yl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[1-(2,4-dichlorophenyl)indol-6-yl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 58285058 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)indol-6-yl]-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cccc(-c2ccc3ccn(-c4ccc(Cl)cc4Cl)c3c2)c1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c24-19-6-7-21(20(25)14-19)27-10-8-15-4-5-17(13-22(15)27)16-2-1-3-18(12-16)23(29)26-9-11-28/h1-8,10,12-14,28H,9,11H2,(H,26,29) |
| InChIKey | IKEOQDZJPLTANU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |