C43H53BN4O4 — CID 58288827
[7-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]-5-oxoheptyl]-methylborinic acid (PubChem CID 58288827) has the molecular formula C43H53BN4O4 and a molecular weight of 700.73 g/mol. Its IUPAC name is [7-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]-5-oxoheptyl]-methylborinic acid.
| Compound Name | [7-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]-5-oxoheptyl]-methylborinic acid |
|---|---|
| PubChem CID | 58288827 |
| Molecular Formula | C43H53BN4O4 |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.42 |
| IUPAC Name | [7-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-22,23-dihydroporphyrin-2-yl]-5-oxoheptyl]-methylborinic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)OC(C)(C)C)C(CCC(=O)CCCCB(C)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C43H53BN4O4/c1-11-30-25(3)34-21-35-27(5)32(17-16-29(49)15-13-14-20-44(10)51)40(47-35)24-41-33(18-19-42(50)52-43(7,8)9)28(6)37(48-41)23-39-31(12-2)26(4)36(46-39)22-38(30)45-34/h11-12,21-24,45-46,51H,1-2,13-20H2,3-10H3/b34-21-,35-21-,36-22-,37-23-,38-22-,39-23-,40-24-,41-24- |
| InChIKey | LSEWKJLALVICAB-WWBAUIQFSA-N |
| XLogP | 10.33 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|