C46H51N5O7 — CID 58288853
3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[6-[2-[2-(3-methyl-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]-3-oxohexyl]-22,23-dihydroporphyrin-2-yl]propanoic acid (PubChem CID 58288853) has the molecular formula C46H51N5O7 and a molecular weight of 785.94 g/mol. Its IUPAC name is 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[6-[2-[2-(3-methyl-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]-3-oxohexyl]-22,23-dihydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[6-[2-[2-(3-methyl-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]-3-oxohexyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 58288853 |
| Molecular Formula | C46H51N5O7 |
| Molecular Weight | 785.94 g/mol |
| Exact Mass | 785.38 |
| IUPAC Name | 3-[7,12-bis(ethenyl)-3,8,13,17-tetramethyl-18-[6-[2-[2-(3-methyl-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]-3-oxohexyl]-22,23-dihydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=O)O)C(CCC(=O)CCCOCCOCCN1C(=O)C=C(C)C1=O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C46H51N5O7/c1-8-32-27(4)36-22-37-29(6)34(13-12-31(52)11-10-17-57-19-20-58-18-16-51-44(53)21-26(3)46(51)56)42(49-37)25-43-35(14-15-45(54)55)30(7)39(50-43)24-41-33(9-2)28(5)38(48-41)23-40(32)47-36/h8-9,21-25,47-48H,1-2,10-20H2,3-7H3,(H,54,55)/b36-22-,37-22-,38-23-,39-24-,40-23-,41-24-,42-25-,43-25- |
| InChIKey | QDVABDFDALZETQ-DBHFNVGMSA-N |
| XLogP | 8.42 |
| TPSA | 167.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.94 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|