C33H58O4 — CID 58289289
6-ethylperoxy-3-(1-hydroperoxyethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 58289289) has the molecular formula C33H58O4 and a molecular weight of 518.82 g/mol. Its IUPAC name is 6-ethylperoxy-3-(1-hydroperoxyethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 6-ethylperoxy-3-(1-hydroperoxyethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58289289 |
| Molecular Formula | C33H58O4 |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.43 |
| IUPAC Name | 6-ethylperoxy-3-(1-hydroperoxyethyl)-4,4,10,13-tetramethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CCOOC1CC2C3CCC(C(C)CCC=C(C)C)C3(C)CCC2C2(C)CCC(C(C)OO)C(C)(C)C12 |
| InChI | InChI=1S/C33H58O4/c1-10-35-37-29-20-24-27-15-14-25(22(4)13-11-12-21(2)3)32(27,8)18-17-28(24)33(9)19-16-26(23(5)36-34)31(6,7)30(29)33/h12,22-30,34H,10-11,13-20H2,1-9H3 |
| InChIKey | QWFQNNPADPISGT-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|