C10H16N2O2 — CID 58291738
1-(2,6-dimethylpyrimidin-4-yl)-2-methylpropane-1,3-diol (PubChem CID 58291738) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2,6-dimethylpyrimidin-4-yl)-2-methylpropane-1,3-diol.
| Compound Name | 1-(2,6-dimethylpyrimidin-4-yl)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 58291738 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(2,6-dimethylpyrimidin-4-yl)-2-methylpropane-1,3-diol |
| SMILES | Cc1cc(C(O)C(C)CO)nc(C)n1 |
| InChI | InChI=1S/C10H16N2O2/c1-6(5-13)10(14)9-4-7(2)11-8(3)12-9/h4,6,10,13-14H,5H2,1-3H3 |
| InChIKey | ZJZUBYUHVJWEHJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |