C10H16N2O — CID 63205554
3-(2,6-dimethylpyrimidin-4-yl)butan-2-ol (PubChem CID 63205554) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(2,6-dimethylpyrimidin-4-yl)butan-2-ol.
| Compound Name | 3-(2,6-dimethylpyrimidin-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 63205554 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-(2,6-dimethylpyrimidin-4-yl)butan-2-ol |
| SMILES | Cc1cc(C(C)C(C)O)nc(C)n1 |
| InChI | InChI=1S/C10H16N2O/c1-6-5-10(7(2)8(3)13)12-9(4)11-6/h5,7-8,13H,1-4H3 |
| InChIKey | ZUVCCRJXSLAEBP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |