C28H38O4 — CID 58297720
2-[4-[3-(2-heptylphenyl)-3-oxopropyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid (PubChem CID 58297720) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[4-[3-(2-heptylphenyl)-3-oxopropyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-(2-heptylphenyl)-3-oxopropyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58297720 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-[4-[3-(2-heptylphenyl)-3-oxopropyl]-2,6-dimethylphenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCc1ccccc1C(=O)CCc1cc(C)c(OC(C)(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C28H38O4/c1-6-7-8-9-10-13-23-14-11-12-15-24(23)25(29)17-16-22-18-20(2)26(21(3)19-22)32-28(4,5)27(30)31/h11-12,14-15,18-19H,6-10,13,16-17H2,1-5H3,(H,30,31) |
| InChIKey | IZJQKAIOKJCQDY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|