C14H21NO4 — CID 58298934
propan-2-yl (E)-7-(2-methylprop-2-enoylamino)-4-oxohept-2-enoate (PubChem CID 58298934) has the molecular formula C14H21NO4 and a molecular weight of 267.33 g/mol. Its IUPAC name is propan-2-yl (E)-7-(2-methylprop-2-enoylamino)-4-oxohept-2-enoate.
| Compound Name | propan-2-yl (E)-7-(2-methylprop-2-enoylamino)-4-oxohept-2-enoate |
|---|---|
| PubChem CID | 58298934 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | propan-2-yl (E)-7-(2-methylprop-2-enoylamino)-4-oxohept-2-enoate |
| SMILES | C=C(C)C(=O)NCCCC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C14H21NO4/c1-10(2)14(18)15-9-5-6-12(16)7-8-13(17)19-11(3)4/h7-8,11H,1,5-6,9H2,2-4H3,(H,15,18)/b8-7+ |
| InChIKey | QDDWQZWRQGZJMH-BQYQJAHWSA-N |
| XLogP | 1.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|