C13H19NO4 — CID 58298919
propan-2-yl (E)-4-oxo-7-(prop-2-enoylamino)hept-2-enoate (PubChem CID 58298919) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is propan-2-yl (E)-4-oxo-7-(prop-2-enoylamino)hept-2-enoate.
| Compound Name | propan-2-yl (E)-4-oxo-7-(prop-2-enoylamino)hept-2-enoate |
|---|---|
| PubChem CID | 58298919 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | propan-2-yl (E)-4-oxo-7-(prop-2-enoylamino)hept-2-enoate |
| SMILES | C=CC(=O)NCCCC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C13H19NO4/c1-4-12(16)14-9-5-6-11(15)7-8-13(17)18-10(2)3/h4,7-8,10H,1,5-6,9H2,2-3H3,(H,14,16)/b8-7+ |
| InChIKey | FDGHLBKLTMLGBA-BQYQJAHWSA-N |
| XLogP | 1.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|