C21H41BN2O5 — CID 58301531
[(1R)-1-[[(2S)-2-(acetamidomethyl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301531) has the molecular formula C21H41BN2O5 and a molecular weight of 412.38 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-(acetamidomethyl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-(acetamidomethyl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301531 |
| Molecular Formula | C21H41BN2O5 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | [(1R)-1-[[(2S)-2-(acetamidomethyl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCCCCCCC(=O)CC(CNC(C)=O)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C21H41BN2O5/c1-5-6-7-8-9-10-11-12-19(26)14-18(15-23-17(4)25)21(27)24-20(22(28)29)13-16(2)3/h16,18,20,28-29H,5-15H2,1-4H3,(H,23,25)(H,24,27)/t18?,20-/m0/s1 |
| InChIKey | QQQMVVLTXADUSG-IJHRGXPZSA-N |
| XLogP | 2.38 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|