About ethyl 2-aminoethanimidothioate
ethyl 2-aminoethanimidothioate (PubChem CID 58305794) has the molecular formula C4H10N2S
and a molecular weight of 118.20 g/mol. Its IUPAC name is ethyl 2-aminoethanimidothioate.
Molecular Properties
| Compound Name | ethyl 2-aminoethanimidothioate |
| PubChem CID | 58305794 |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | ethyl 2-aminoethanimidothioate |
| SMILES | [H]/N=C(\CN)SCC |
| InChI | InChI=1S/C4H10N2S/c1-2-7-4(6)3-5/h6H,2-3,5H2,1H3/b6-4+ |
| InChIKey | BNKXBCMMLHKQEZ-GQCTYLIASA-N |
| XLogP | 0.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-aminoethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-aminoethanimidothioate?
The IUPAC name of ethyl 2-aminoethanimidothioate (CID 58305794) is ethyl 2-aminoethanimidothioate.
What is the SMILES notation for ethyl 2-aminoethanimidothioate?
The canonical SMILES for ethyl 2-aminoethanimidothioate is [H]/N=C(\CN)SCC.
What is the InChIKey of ethyl 2-aminoethanimidothioate?
The InChIKey is BNKXBCMMLHKQEZ-GQCTYLIASA-N. The full InChI is InChI=1S/C4H10N2S/c1-2-7-4(6)3-5/h6H,2-3,5H2,1H3/b6-4+.
What are the key properties of ethyl 2-aminoethanimidothioate?
ethyl 2-aminoethanimidothioate has a molecular weight of 118.20 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-aminoethanimidothioate is sourced from PubChem (CID 58305794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).