C7H10O4 — CID 58307719
5-ethenylperoxypentane-2,3-dione (PubChem CID 58307719) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 5-ethenylperoxypentane-2,3-dione.
| Compound Name | 5-ethenylperoxypentane-2,3-dione |
|---|---|
| PubChem CID | 58307719 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-ethenylperoxypentane-2,3-dione |
| SMILES | C=COOCCC(=O)C(C)=O |
| InChI | InChI=1S/C7H10O4/c1-3-10-11-5-4-7(9)6(2)8/h3H,1,4-5H2,2H3 |
| InChIKey | HCUWMUHTVWDEFB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|