C32H53NO5 — CID 58311087
methyl 4-oxo-5-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]hexanoate (PubChem CID 58311087) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is methyl 4-oxo-5-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]hexanoate.
| Compound Name | methyl 4-oxo-5-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]hexanoate |
|---|---|
| PubChem CID | 58311087 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | methyl 4-oxo-5-[(3S,14R,17S,18R)-3,4,4,19,19-pentamethyl-2,16-dioxo-1-azatricyclo[15.4.0.018,20]henicosan-14-yl]hexanoate |
| SMILES | COC(=O)CCC(=O)C(C)[C@@H]1CCCCCCCCCC(C)(C)[C@H](C)C(=O)N2CC3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C32H53NO5/c1-21(25(34)16-17-27(36)38-7)23-15-13-11-9-8-10-12-14-18-31(3,4)22(2)30(37)33-20-24-28(32(24,5)6)29(33)26(35)19-23/h21-24,28-29H,8-20H2,1-7H3/t21?,22-,23-,24?,28+,29-/m1/s1 |
| InChIKey | UHPVVPXFWMIOFW-VAIFHOFJSA-N |
| XLogP | 6.39 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |