C26H43NO3 — CID 58311423
methyl (3S,14R,17S)-3,19,19-trimethyl-16-methylidene-2-oxo-1-azatricyclo[15.4.0.018,20]henicosane-14-carboxylate (PubChem CID 58311423) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is methyl (3S,14R,17S)-3,19,19-trimethyl-16-methylidene-2-oxo-1-azatricyclo[15.4.0.018,20]henicosane-14-carboxylate.
| Compound Name | methyl (3S,14R,17S)-3,19,19-trimethyl-16-methylidene-2-oxo-1-azatricyclo[15.4.0.018,20]henicosane-14-carboxylate |
|---|---|
| PubChem CID | 58311423 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | methyl (3S,14R,17S)-3,19,19-trimethyl-16-methylidene-2-oxo-1-azatricyclo[15.4.0.018,20]henicosane-14-carboxylate |
| SMILES | C=C1C[C@H](C(=O)OC)CCCCCCCCCC[C@H](C)C(=O)N2CC3C([C@@H]12)C3(C)C |
| InChI | InChI=1S/C26H43NO3/c1-18-14-12-10-8-6-7-9-11-13-15-20(25(29)30-5)16-19(2)23-22-21(26(22,3)4)17-27(23)24(18)28/h18,20-23H,2,6-17H2,1,3-5H3/t18-,20+,21?,22?,23+/m0/s1 |
| InChIKey | CSTDTKUBGDVEBQ-DBKGGTFJSA-N |
| XLogP | 5.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|