C44H78Cl3N2O8P — CID 58320273
[(2R,3R,4R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-6-ethyl-4-[(3R)-3-methyldecoxy]-3-[[(Z)-octadec-11-enoyl]amino]oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 58320273) has the molecular formula C44H78Cl3N2O8P and a molecular weight of 900.45 g/mol. Its IUPAC name is [(2R,3R,4R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-6-ethyl-4-[(3R)-3-methyldecoxy]-3-[[(Z)-octadec-11-enoyl]amino]oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R,4R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-6-ethyl-4-[(3R)-3-methyldecoxy]-3-[[(Z)-octadec-11-enoyl]amino]oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 58320273 |
| Molecular Formula | C44H78Cl3N2O8P |
| Molecular Weight | 900.45 g/mol |
| Exact Mass | 898.46 |
| IUPAC Name | [(2R,3R,4R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-6-ethyl-4-[(3R)-3-methyldecoxy]-3-[[(Z)-octadec-11-enoyl]amino]oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](CC)C(OP(=O)(OCC=C)OCC=C)[C@H](OCC[C@H](C)CCCCCCC)[C@H]1NC(=O)CCCCCCCCC/C=C\CCCCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H78Cl3N2O8P/c1-7-12-14-16-17-18-19-20-21-22-23-24-25-27-29-31-38(50)49-39-41(52-35-32-36(6)30-28-26-15-13-8-2)40(57-58(51,53-33-9-3)54-34-10-4)37(11-5)55-42(39)56-43(48)44(45,46)47/h9-10,18-19,36-37,39-42,48H,3-4,7-8,11-17,20-35H2,1-2,5-6H3,(H,49,50)/b19-18-,48-43+/t36-,37-,39-,40?,41-,42-/m1/s1 |
| InChIKey | SPRFZPJDSPGUCP-FNEWKVANSA-N |
| XLogP | 13.68 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.45 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|