C44H77Cl3NO11P — CID 87634316
[(2R,3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] (Z)-octadec-11-enoate (PubChem CID 87634316) has the molecular formula C44H77Cl3NO11P and a molecular weight of 933.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2R,3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 87634316 |
| Molecular Formula | C44H77Cl3NO11P |
| Molecular Weight | 933.43 g/mol |
| Exact Mass | 931.43 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] (Z)-octadec-11-enoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC)[C@@H](OP(=O)(OCC=C)OCC=C)[C@H](OCC[C@@H](CCCCCCC)OC)[C@H]1OC(=O)CCCCCCCCC/C=C\CCCCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H77Cl3NO11P/c1-7-11-13-15-16-17-18-19-20-21-22-23-24-26-28-30-38(49)57-41-40(53-34-31-36(52-6)29-27-25-14-12-8-2)39(59-60(50,54-32-9-3)55-33-10-4)37(35-51-5)56-42(41)58-43(48)44(45,46)47/h9-10,17-18,36-37,39-42,48H,3-4,7-8,11-16,19-35H2,1-2,5-6H3/b18-17-,48-43+/t36-,37-,39-,40+,41-,42-/m1/s1 |
| InChIKey | OAKBOKUALFBHRD-IOHXHLTMSA-N |
| XLogP | 12.72 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.43 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|