C44H79Cl3NO10P — CID 87632726
[(3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-3-[(Z)-octadec-11-enoxy]oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 87632726) has the molecular formula C44H79Cl3NO10P and a molecular weight of 919.45 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-3-[(Z)-octadec-11-enoxy]oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-3-[(Z)-octadec-11-enoxy]oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 87632726 |
| Molecular Formula | C44H79Cl3NO10P |
| Molecular Weight | 919.45 g/mol |
| Exact Mass | 917.45 |
| IUPAC Name | [(3R,4R,5R,6R)-5-bis(prop-2-enoxy)phosphoryloxy-4-[(3R)-3-methoxydecoxy]-6-(methoxymethyl)-3-[(Z)-octadec-11-enoxy]oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](COC)[C@@H](OP(=O)(OCC=C)OCC=C)[C@H](OCC[C@@H](CCCCCCC)OC)[C@H]1OCCCCCCCCCC/C=C\CCCCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H79Cl3NO10P/c1-7-11-13-15-16-17-18-19-20-21-22-23-24-25-27-29-34-52-41-40(53-35-31-37(51-6)30-28-26-14-12-8-2)39(58-59(49,54-32-9-3)55-33-10-4)38(36-50-5)56-42(41)57-43(48)44(45,46)47/h9-10,17-18,37-42,48H,3-4,7-8,11-16,19-36H2,1-2,5-6H3/b18-17-,48-43+/t37-,38-,39-,40+,41-,42?/m1/s1 |
| InChIKey | BRMLGWXQGZCCIS-QRCGWJRASA-N |
| XLogP | 13.19 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.45 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|