C25H25N3 — CID 58326538
N-benzyl-N-methyl-4-(2,4,6-trimethylphenyl)phthalazin-1-amine (PubChem CID 58326538) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-(2,4,6-trimethylphenyl)phthalazin-1-amine.
| Compound Name | N-benzyl-N-methyl-4-(2,4,6-trimethylphenyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 58326538 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-benzyl-N-methyl-4-(2,4,6-trimethylphenyl)phthalazin-1-amine |
| SMILES | Cc1cc(C)c(-c2nnc(N(C)Cc3ccccc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C25H25N3/c1-17-14-18(2)23(19(3)15-17)24-21-12-8-9-13-22(21)25(27-26-24)28(4)16-20-10-6-5-7-11-20/h5-15H,16H2,1-4H3 |
| InChIKey | WSOOYZZLGWHRNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |