C26H26ClN3O5S — CID 58329421
3-(3-chlorophenyl)-7-methoxy-1-[4-(methylsulfonylmethyl)cyclohexyl]pyrimido[5,4-c]quinoline-2,4-dione (PubChem CID 58329421) has the molecular formula C26H26ClN3O5S and a molecular weight of 528.03 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-7-methoxy-1-[4-(methylsulfonylmethyl)cyclohexyl]pyrimido[5,4-c]quinoline-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-7-methoxy-1-[4-(methylsulfonylmethyl)cyclohexyl]pyrimido[5,4-c]quinoline-2,4-dione |
|---|---|
| PubChem CID | 58329421 |
| Molecular Formula | C26H26ClN3O5S |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 3-(3-chlorophenyl)-7-methoxy-1-[4-(methylsulfonylmethyl)cyclohexyl]pyrimido[5,4-c]quinoline-2,4-dione |
| SMILES | COc1cccc2c1ncc1c(=O)n(-c3cccc(Cl)c3)c(=O)n(C3CCC(CS(C)(=O)=O)CC3)c12 |
| InChI | InChI=1S/C26H26ClN3O5S/c1-35-22-8-4-7-20-23(22)28-14-21-24(20)29(18-11-9-16(10-12-18)15-36(2,33)34)26(32)30(25(21)31)19-6-3-5-17(27)13-19/h3-8,13-14,16,18H,9-12,15H2,1-2H3 |
| InChIKey | LTWZVVKVKAMGQS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|