C15H13N5OS — CID 58338482
1-phenyl-3-(1H-pyrrolo[2,3-b]pyridine-3-carbonylamino)thiourea (PubChem CID 58338482) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-phenyl-3-(1H-pyrrolo[2,3-b]pyridine-3-carbonylamino)thiourea.
| Compound Name | 1-phenyl-3-(1H-pyrrolo[2,3-b]pyridine-3-carbonylamino)thiourea |
|---|---|
| PubChem CID | 58338482 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-phenyl-3-(1H-pyrrolo[2,3-b]pyridine-3-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C15H13N5OS/c21-14(12-9-17-13-11(12)7-4-8-16-13)19-20-15(22)18-10-5-2-1-3-6-10/h1-9H,(H,16,17)(H,19,21)(H2,18,20,22) |
| InChIKey | IJXOJGUMTHCBAG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|