About aniline;methylbenzene;yttrium
aniline;methylbenzene;yttrium (PubChem CID 58340337) has the molecular formula C13H13NY-2
and a molecular weight of 272.16 g/mol. Its IUPAC name is aniline;methylbenzene;yttrium.
Molecular Properties
| Compound Name | aniline;methylbenzene;yttrium |
| PubChem CID | 58340337 |
| Molecular Formula | C13H13NY-2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | aniline;methylbenzene;yttrium |
| SMILES | Cc1cc[c-]cc1.Nc1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C7H7.C6H6N.Y/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6;/h3-6H,1H3;2-5H,7H2;/q2*-1; |
| InChIKey | DGKDISKYAFOSBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze aniline;methylbenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;methylbenzene;yttrium?
The IUPAC name of aniline;methylbenzene;yttrium (CID 58340337) is aniline;methylbenzene;yttrium.
What is the SMILES notation for aniline;methylbenzene;yttrium?
The canonical SMILES for aniline;methylbenzene;yttrium is Cc1cc[c-]cc1.Nc1cc[c-]cc1.[Y].
What is the InChIKey of aniline;methylbenzene;yttrium?
The InChIKey is DGKDISKYAFOSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C6H6N.Y/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6;/h3-6H,1H3;2-5H,7H2;/q2*-1;.
What are the key properties of aniline;methylbenzene;yttrium?
aniline;methylbenzene;yttrium has a molecular weight of 272.16 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;methylbenzene;yttrium is sourced from PubChem (CID 58340337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).