C14H21N3O5 — CID 58340888
2-(2,5-dioxopyrrol-1-yl)-N-[1-(2-ethoxypropanoylamino)ethyl]propanamide (PubChem CID 58340888) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-[1-(2-ethoxypropanoylamino)ethyl]propanamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-[1-(2-ethoxypropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 58340888 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-[1-(2-ethoxypropanoylamino)ethyl]propanamide |
| SMILES | CCOC(C)C(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H21N3O5/c1-5-22-9(3)14(21)16-10(4)15-13(20)8(2)17-11(18)6-7-12(17)19/h6-10H,5H2,1-4H3,(H,15,20)(H,16,21) |
| InChIKey | XJYJIAKVUMUTPI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|