C33H47N9O13 — CID 88560730
methyl N-[1-[[1,5-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 88560730) has the molecular formula C33H47N9O13 and a molecular weight of 777.79 g/mol. Its IUPAC name is methyl N-[1-[[1,5-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[1,5-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 88560730 |
| Molecular Formula | C33H47N9O13 |
| Molecular Weight | 777.79 g/mol |
| Exact Mass | 777.33 |
| IUPAC Name | methyl N-[1-[[1,5-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,5-dioxopentan-3-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COC(=O)NCCCCC(NC(=O)OC)C(=O)NC(CC(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O)CC(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C33H47N9O13/c1-17(41-25(45)10-11-26(41)46)29(49)37-19(3)35-23(43)15-21(39-31(51)22(40-33(53)55-6)9-7-8-14-34-32(52)54-5)16-24(44)36-20(4)38-30(50)18(2)42-27(47)12-13-28(42)48/h10-13,17-22H,7-9,14-16H2,1-6H3,(H,34,52)(H,35,43)(H,36,44)(H,37,49)(H,38,50)(H,39,51)(H,40,53) |
| InChIKey | DLIFJMSTUMEQHW-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 296.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.79 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|