C32H45N9O13 — CID 89072508
methyl N-[1-[[1,4-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 89072508) has the molecular formula C32H45N9O13 and a molecular weight of 763.76 g/mol. Its IUPAC name is methyl N-[1-[[1,4-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[1,4-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 89072508 |
| Molecular Formula | C32H45N9O13 |
| Molecular Weight | 763.76 g/mol |
| Exact Mass | 763.31 |
| IUPAC Name | methyl N-[1-[[1,4-bis[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-1,4-dioxobutan-2-yl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COC(=O)NCCCCC(NC(=O)OC)C(=O)NC(CC(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O)C(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C32H45N9O13/c1-16(40-23(43)10-11-24(40)44)27(47)35-18(3)34-22(42)15-21(30(50)37-19(4)36-28(48)17(2)41-25(45)12-13-26(41)46)38-29(49)20(39-32(52)54-6)9-7-8-14-33-31(51)53-5/h10-13,16-21H,7-9,14-15H2,1-6H3,(H,33,51)(H,34,42)(H,35,47)(H,36,48)(H,37,50)(H,38,49)(H,39,52) |
| InChIKey | MUHDHTHDRUWFAF-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 296.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.76 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|