C27H37N7O10 — CID 157358473
N-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-(2-ethoxypropanoylamino)butanediamide (PubChem CID 157358473) has the molecular formula C27H37N7O10 and a molecular weight of 619.63 g/mol. Its IUPAC name is N-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-(2-ethoxypropanoylamino)butanediamide.
| Compound Name | N-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-(2-ethoxypropanoylamino)butanediamide |
|---|---|
| PubChem CID | 157358473 |
| Molecular Formula | C27H37N7O10 |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | N-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-N'-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-2-(2-ethoxypropanoylamino)butanediamide |
| SMILES | CCOC(C)C(=O)NC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H37N7O10/c1-5-44-16(3)26(42)32-18(27(43)31-17(4)30-25(41)15(2)34-23(39)8-9-24(34)40)14-20(36)29-12-11-28-19(35)10-13-33-21(37)6-7-22(33)38/h6-9,15-18H,5,10-14H2,1-4H3,(H,28,35)(H,29,36)(H,30,41)(H,31,43)(H,32,42) |
| InChIKey | BIJACOSOOABXRC-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 229.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|