C22H33N7O6 — CID 88555469
2-(2,5-dioxopyrrol-1-yl)-N-[1-[1-[1-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide (PubChem CID 88555469) has the molecular formula C22H33N7O6 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-[1-[1-[1-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-[1-[1-[1-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 88555469 |
| Molecular Formula | C22H33N7O6 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-[1-[1-[1-[1-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]ethylamino]ethylamino]ethyl]propanamide |
| SMILES | CC(NC(=O)C(C)N1C(=O)C=CC1=O)NC(C)NC(C)NC(C)NC(=O)C(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H33N7O6/c1-11(28-17(30)7-8-18(28)31)21(34)26-15(5)24-13(3)23-14(4)25-16(6)27-22(35)12(2)29-19(32)9-10-20(29)33/h7-16,23-25H,1-6H3,(H,26,34)(H,27,35) |
| InChIKey | PKFYFQKHCRNSHS-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|