C27H32N2O4 — CID 58343348
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-(2-piperidin-3-ylethyl)phenyl]ethynyl]benzamide (PubChem CID 58343348) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-(2-piperidin-3-ylethyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-(2-piperidin-3-ylethyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58343348 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[2-[4-(2-piperidin-3-ylethyl)phenyl]ethynyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(CCC3CCCNC3)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C27H32N2O4/c1-19(31)26(25(32)18-30)29-27(33)24-14-12-22(13-15-24)9-8-20-4-6-21(7-5-20)10-11-23-3-2-16-28-17-23/h4-7,12-15,19,23,26,28,30-31H,2-3,10-11,16-18H2,1H3,(H,29,33)/t19-,23?,26+/m1/s1 |
| InChIKey | ZRKAZIWGCSTMDZ-YBFKRTLCSA-N |
| XLogP | 2.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|