C31H49N3O2 — CID 58348952
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[(E)-but-2-enoyl]amino]ethyl-methylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 58348952) has the molecular formula C31H49N3O2 and a molecular weight of 495.75 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[(E)-but-2-enoyl]amino]ethyl-methylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[(E)-but-2-enoyl]amino]ethyl-methylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 58348952 |
| Molecular Formula | C31H49N3O2 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.38 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[(E)-but-2-enoyl]amino]ethyl-methylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | C/C=C/C(=O)NCCN(C)CCNC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C31H49N3O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-31(36)33-27-29-34(3)28-26-32-30(35)24-5-2/h5-7,9-10,12-13,15-16,18-19,21-22,24H,4,8,11,14,17,20,23,25-29H2,1-3H3,(H,32,35)(H,33,36)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-,24-5+ |
| InChIKey | HWAJWASUEHKBNN-AYIYSPOXSA-N |
| XLogP | 6.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|