C14H17NO4 — CID 58350463
[4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]methyl acetate (PubChem CID 58350463) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]methyl acetate.
| Compound Name | [4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58350463 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [4,6-bis(ethenyl)-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]methyl acetate |
| SMILES | C=CC1CC(C=C)C2C(=O)N(COC(C)=O)C(=O)C12 |
| InChI | InChI=1S/C14H17NO4/c1-4-9-6-10(5-2)12-11(9)13(17)15(14(12)18)7-19-8(3)16/h4-5,9-12H,1-2,6-7H2,3H3 |
| InChIKey | VDVYJVCYMJKLMZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|