About N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium
N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium (PubChem CID 58360887) has the molecular formula C10H13NWY-2
and a molecular weight of 419.97 g/mol. Its IUPAC name is N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium.
Molecular Properties
| Compound Name | N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium |
| PubChem CID | 58360887 |
| Molecular Formula | C10H13NWY-2 |
| Molecular Weight | 419.97 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium |
| SMILES | [CH2-]C(c1ccccc1)N([CH2-])C.[W].[Y] |
| InChI | InChI=1S/C10H13N.W.Y/c1-9(11(2)3)10-7-5-4-6-8-10;;/h4-9H,1-2H2,3H3;;/q-2;; |
| InChIKey | ZUYOKQJFCWKSMK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.97 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium?
The IUPAC name of N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium (CID 58360887) is N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium.
What is the SMILES notation for N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium?
The canonical SMILES for N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium is [CH2-]C(c1ccccc1)N([CH2-])C.[W].[Y].
What is the InChIKey of N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium?
The InChIKey is ZUYOKQJFCWKSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.W.Y/c1-9(11(2)3)10-7-5-4-6-8-10;;/h4-9H,1-2H2,3H3;;/q-2;;.
What are the key properties of N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium?
N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium has a molecular weight of 419.97 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methanidyl-N-methyl-1-phenylethanamine;tungsten;yttrium is sourced from PubChem (CID 58360887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).