C27H29N3O4S — CID 58362742
(16R,17R)-17-hydroxy-10,13,16-trimethyl-3,11-dioxo-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 58362742) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is (16R,17R)-17-hydroxy-10,13,16-trimethyl-3,11-dioxo-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (16R,17R)-17-hydroxy-10,13,16-trimethyl-3,11-dioxo-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 58362742 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (16R,17R)-17-hydroxy-10,13,16-trimethyl-3,11-dioxo-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(=O)CC2(C)[C@@]1(O)C(=O)Nc1nc2cccnc2s1 |
| InChI | InChI=1S/C27H29N3O4S/c1-14-11-18-17-7-6-15-12-16(31)8-9-25(15,2)21(17)20(32)13-26(18,3)27(14,34)23(33)30-24-29-19-5-4-10-28-22(19)35-24/h4-5,8-10,12,14,17-18,21,34H,6-7,11,13H2,1-3H3,(H,29,30,33)/t14-,17?,18?,21?,25?,26?,27+/m1/s1 |
| InChIKey | LSKMHAKSYNYDNU-NVRIZZQGSA-N |
| XLogP | 4.09 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |