C12H21F3N2O2 — CID 58363651
3-(tert-butylamino)-2-oxo-N-(2,2,2-trifluoroethyl)hexanamide (PubChem CID 58363651) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 3-(tert-butylamino)-2-oxo-N-(2,2,2-trifluoroethyl)hexanamide.
| Compound Name | 3-(tert-butylamino)-2-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
|---|---|
| PubChem CID | 58363651 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-(tert-butylamino)-2-oxo-N-(2,2,2-trifluoroethyl)hexanamide |
| SMILES | CCCC(NC(C)(C)C)C(=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2/c1-5-6-8(17-11(2,3)4)9(18)10(19)16-7-12(13,14)15/h8,17H,5-7H2,1-4H3,(H,16,19) |
| InChIKey | PSZTXQZZRNRTDT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|