C31H58F3NOS — CID 166860269
(Z)-4-hexyl-2-tridecan-7-ylsulfanyl-N-(2,2,2-trifluoroethyl)dec-2-enamide (PubChem CID 166860269) has the molecular formula C31H58F3NOS and a molecular weight of 549.87 g/mol. Its IUPAC name is (Z)-4-hexyl-2-tridecan-7-ylsulfanyl-N-(2,2,2-trifluoroethyl)dec-2-enamide.
| Compound Name | (Z)-4-hexyl-2-tridecan-7-ylsulfanyl-N-(2,2,2-trifluoroethyl)dec-2-enamide |
|---|---|
| PubChem CID | 166860269 |
| Molecular Formula | C31H58F3NOS |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 549.42 |
| IUPAC Name | (Z)-4-hexyl-2-tridecan-7-ylsulfanyl-N-(2,2,2-trifluoroethyl)dec-2-enamide |
| SMILES | CCCCCCC(/C=C(\SC(CCCCCC)CCCCCC)C(=O)NCC(F)(F)F)CCCCCC |
| InChI | InChI=1S/C31H58F3NOS/c1-5-9-13-17-21-27(22-18-14-10-6-2)25-29(30(36)35-26-31(32,33)34)37-28(23-19-15-11-7-3)24-20-16-12-8-4/h25,27-28H,5-24,26H2,1-4H3,(H,35,36)/b29-25- |
| InChIKey | MRGUZKHFKOBMPE-GNVQSUKOSA-N |
| XLogP | 11.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|