C18H32F3NO — CID 130278913
2-pentyl-1-[1-(2,2,2-trifluoroethylamino)cyclopropyl]octan-1-one (PubChem CID 130278913) has the molecular formula C18H32F3NO and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-pentyl-1-[1-(2,2,2-trifluoroethylamino)cyclopropyl]octan-1-one.
| Compound Name | 2-pentyl-1-[1-(2,2,2-trifluoroethylamino)cyclopropyl]octan-1-one |
|---|---|
| PubChem CID | 130278913 |
| Molecular Formula | C18H32F3NO |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2-pentyl-1-[1-(2,2,2-trifluoroethylamino)cyclopropyl]octan-1-one |
| SMILES | CCCCCCC(CCCCC)C(=O)C1(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H32F3NO/c1-3-5-7-9-11-15(10-8-6-4-2)16(23)17(12-13-17)22-14-18(19,20)21/h15,22H,3-14H2,1-2H3 |
| InChIKey | GIOJYWJGSCGLJR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|