C9H15F3N2O2 — CID 173113648
3-methyl-2-(2,2,2-trifluoroethylhydrazinylidene)hexanoic acid (PubChem CID 173113648) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethylhydrazinylidene)hexanoic acid.
| Compound Name | 3-methyl-2-(2,2,2-trifluoroethylhydrazinylidene)hexanoic acid |
|---|---|
| PubChem CID | 173113648 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-methyl-2-(2,2,2-trifluoroethylhydrazinylidene)hexanoic acid |
| SMILES | CCCC(C)C(=NNCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3N2O2/c1-3-4-6(2)7(8(15)16)14-13-5-9(10,11)12/h6,13H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | OGVUOXILSQQTBJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|