C43H31N7 — CID 58382636
2-[3,5-bis(4-pyrimidin-2-ylphenyl)phenyl]-4,6-bis(4-methylphenyl)-1,3,5-triazine (PubChem CID 58382636) has the molecular formula C43H31N7 and a molecular weight of 645.77 g/mol. Its IUPAC name is 2-[3,5-bis(4-pyrimidin-2-ylphenyl)phenyl]-4,6-bis(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(4-pyrimidin-2-ylphenyl)phenyl]-4,6-bis(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58382636 |
| Molecular Formula | C43H31N7 |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 2-[3,5-bis(4-pyrimidin-2-ylphenyl)phenyl]-4,6-bis(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3cc(-c4ccc(-c5ncccn5)cc4)cc(-c4ccc(-c5ncccn5)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C43H31N7/c1-28-5-9-34(10-6-28)41-48-42(35-11-7-29(2)8-12-35)50-43(49-41)38-26-36(30-13-17-32(18-14-30)39-44-21-3-22-45-39)25-37(27-38)31-15-19-33(20-16-31)40-46-23-4-24-47-40/h3-27H,1-2H3 |
| InChIKey | QOGBQMQBJFFHRB-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |