C24H35FO3 — CID 58383184
8-fluoro-3-propyl-7-[2-(4-propylcyclohexyl)ethoxymethyl]-3,4-dihydrochromen-2-one (PubChem CID 58383184) has the molecular formula C24H35FO3 and a molecular weight of 390.54 g/mol. Its IUPAC name is 8-fluoro-3-propyl-7-[2-(4-propylcyclohexyl)ethoxymethyl]-3,4-dihydrochromen-2-one.
| Compound Name | 8-fluoro-3-propyl-7-[2-(4-propylcyclohexyl)ethoxymethyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 58383184 |
| Molecular Formula | C24H35FO3 |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 8-fluoro-3-propyl-7-[2-(4-propylcyclohexyl)ethoxymethyl]-3,4-dihydrochromen-2-one |
| SMILES | CCCC1CCC(CCOCc2ccc3c(c2F)OC(=O)C(CCC)C3)CC1 |
| InChI | InChI=1S/C24H35FO3/c1-3-5-17-7-9-18(10-8-17)13-14-27-16-21-12-11-19-15-20(6-4-2)24(26)28-23(19)22(21)25/h11-12,17-18,20H,3-10,13-16H2,1-2H3 |
| InChIKey | QQUGSUCLHIGGFR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|