C22H31FO4 — CID 58383157
8-fluoro-7-[hydroperoxy-(4-propylcyclohexyl)methyl]-3-propyl-3,4-dihydrochromen-2-one (PubChem CID 58383157) has the molecular formula C22H31FO4 and a molecular weight of 378.48 g/mol. Its IUPAC name is 8-fluoro-7-[hydroperoxy-(4-propylcyclohexyl)methyl]-3-propyl-3,4-dihydrochromen-2-one.
| Compound Name | 8-fluoro-7-[hydroperoxy-(4-propylcyclohexyl)methyl]-3-propyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 58383157 |
| Molecular Formula | C22H31FO4 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 8-fluoro-7-[hydroperoxy-(4-propylcyclohexyl)methyl]-3-propyl-3,4-dihydrochromen-2-one |
| SMILES | CCCC1CCC(C(OO)c2ccc3c(c2F)OC(=O)C(CCC)C3)CC1 |
| InChI | InChI=1S/C22H31FO4/c1-3-5-14-7-9-15(10-8-14)20(27-25)18-12-11-16-13-17(6-4-2)22(24)26-21(16)19(18)23/h11-12,14-15,17,20,25H,3-10,13H2,1-2H3 |
| InChIKey | OQBHLOGLPPMYDF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|