C19H22N2O2 — CID 58384711
tert-butyl (2S)-2-(5-ethynyl-3H-indol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 58384711) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-(5-ethynyl-3H-indol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(5-ethynyl-3H-indol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58384711 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl (2S)-2-(5-ethynyl-3H-indol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C#Cc1ccc2c(c1)CC([C@@H]1CCCN1C(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C19H22N2O2/c1-5-13-8-9-15-14(11-13)12-16(20-15)17-7-6-10-21(17)18(22)23-19(2,3)4/h1,8-9,11,17H,6-7,10,12H2,2-4H3/t17-/m0/s1 |
| InChIKey | TYHWKKHAOBSLAG-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|